C14H26O5 — CID 134855122
(2R,3S,4R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxypentanal (PubChem CID 134855122) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,3S,4R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxypentanal.
| Compound Name | (2R,3S,4R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxypentanal |
|---|---|
| PubChem CID | 134855122 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (2R,3S,4R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-4-methyl-3-propan-2-yloxypentanal |
| SMILES | CC(C)O[C@@H]([C@H](C)C[C@@H]1COC(C)(C)O1)[C@@H](O)C=O |
| InChI | InChI=1S/C14H26O5/c1-9(2)18-13(12(16)7-15)10(3)6-11-8-17-14(4,5)19-11/h7,9-13,16H,6,8H2,1-5H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | FAPRZPDVORXKNA-NDBYEHHHSA-N |
| XLogP | 1.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|