C28H33NO5 — CID 134855539
methyl 3-[3-[benzyl-(3-ethoxy-3-oxopropanoyl)amino]oct-1-ynyl]benzoate (PubChem CID 134855539) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is methyl 3-[3-[benzyl-(3-ethoxy-3-oxopropanoyl)amino]oct-1-ynyl]benzoate.
| Compound Name | methyl 3-[3-[benzyl-(3-ethoxy-3-oxopropanoyl)amino]oct-1-ynyl]benzoate |
|---|---|
| PubChem CID | 134855539 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | methyl 3-[3-[benzyl-(3-ethoxy-3-oxopropanoyl)amino]oct-1-ynyl]benzoate |
| SMILES | CCCCCC(C#Cc1cccc(C(=O)OC)c1)N(Cc1ccccc1)C(=O)CC(=O)OCC |
| InChI | InChI=1S/C28H33NO5/c1-4-6-8-16-25(18-17-22-14-11-15-24(19-22)28(32)33-3)29(21-23-12-9-7-10-13-23)26(30)20-27(31)34-5-2/h7,9-15,19,25H,4-6,8,16,20-21H2,1-3H3 |
| InChIKey | DNSNMYHVCUYOSS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|