C24H26F3NO5 — CID 171990093
ethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]-2-(trifluoromethyl)benzoate (PubChem CID 171990093) has the molecular formula C24H26F3NO5 and a molecular weight of 465.47 g/mol. Its IUPAC name is ethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]-2-(trifluoromethyl)benzoate.
| Compound Name | ethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 171990093 |
| Molecular Formula | C24H26F3NO5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | ethyl 4-[[(3-acetyloxy-2-phenylpropanoyl)-ethylamino]methyl]-2-(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1ccc(CN(CC)C(=O)C(COC(C)=O)c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H26F3NO5/c1-4-28(22(30)20(15-33-16(3)29)18-9-7-6-8-10-18)14-17-11-12-19(23(31)32-5-2)21(13-17)24(25,26)27/h6-13,20H,4-5,14-15H2,1-3H3 |
| InChIKey | YISGSFNMDXRWJD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |