About methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate
methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate (PubChem CID 3247418) has the molecular formula C24H26F3NO3
and a molecular weight of 433.47 g/mol. Its IUPAC name is methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate |
| PubChem CID | 3247418 |
| Molecular Formula | C24H26F3NO3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate |
| SMILES | CCCC[C@@H]1C[C@H]1[C@@H](NC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C24H26F3NO3/c1-3-4-5-18-14-20(18)21(15-6-8-17(9-7-15)23(30)31-2)28-22(29)16-10-12-19(13-11-16)24(25,26)27/h6-13,18,20-21H,3-5,14H2,1-2H3,(H,28,29)/t18-,20-,21+/m1/s1 |
| InChIKey | KCRKNXMAIHXDOP-NRSPTQNISA-N |
| XLogP | 5.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate?
The IUPAC name of methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate (CID 3247418) is methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate.
What is the SMILES notation for methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate?
The canonical SMILES for methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate is CCCC[C@@H]1C[C@H]1[C@@H](NC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate?
The InChIKey is KCRKNXMAIHXDOP-NRSPTQNISA-N. The full InChI is InChI=1S/C24H26F3NO3/c1-3-4-5-18-14-20(18)21(15-6-8-17(9-7-15)23(30)31-2)28-22(29)16-10-12-19(13-11-16)24(25,26)27/h6-13,18,20-21H,3-5,14H2,1-2H3,(H,28,29)/t18-,20-,21+/m1/s1.
What are the key properties of methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate?
methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate has a molecular weight of 433.47 g/mol, XLogP of 5.79, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(R)-[(1R,2R)-2-butylcyclopropyl]-[[4-(trifluoromethyl)benzoyl]amino]methyl]benzoate is sourced from PubChem (CID 3247418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).