C22H24F3NO — CID 22525611
N-[[(1S,2R)-2-butylcyclopropyl]-[2-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 22525611) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[[(1S,2R)-2-butylcyclopropyl]-[2-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | N-[[(1S,2R)-2-butylcyclopropyl]-[2-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 22525611 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[[(1S,2R)-2-butylcyclopropyl]-[2-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | CCCC[C@@H]1C[C@@H]1C(NC(=O)c1ccccc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H24F3NO/c1-2-3-9-16-14-18(16)20(26-21(27)15-10-5-4-6-11-15)17-12-7-8-13-19(17)22(23,24)25/h4-8,10-13,16,18,20H,2-3,9,14H2,1H3,(H,26,27)/t16-,18+,20?/m1/s1 |
| InChIKey | KDJMZWFIOYFKDF-MARPTJLWSA-N |
| XLogP | 6.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |