C13H22O4 — CID 134855847
(2S,4S)-4-[(Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2-methyl-1,3-dioxane (PubChem CID 134855847) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (2S,4S)-4-[(Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2-methyl-1,3-dioxane.
| Compound Name | (2S,4S)-4-[(Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 134855847 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2S,4S)-4-[(Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-1-enyl]-2-methyl-1,3-dioxane |
| SMILES | C[C@H]1OCC[C@@H](/C=C\C[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H22O4/c1-10-14-8-7-11(16-10)5-4-6-12-9-15-13(2,3)17-12/h4-5,10-12H,6-9H2,1-3H3/b5-4-/t10-,11+,12-/m0/s1 |
| InChIKey | ZQXJDNUBXNLCGG-LNDCSFGSSA-N |
| XLogP | 2.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|