C15H20O3Se — CID 134856032
methyl (E,2R,3S)-3-hydroxy-2-phenylselanyloct-4-enoate (PubChem CID 134856032) has the molecular formula C15H20O3Se and a molecular weight of 327.28 g/mol. Its IUPAC name is methyl (E,2R,3S)-3-hydroxy-2-phenylselanyloct-4-enoate.
| Compound Name | methyl (E,2R,3S)-3-hydroxy-2-phenylselanyloct-4-enoate |
|---|---|
| PubChem CID | 134856032 |
| Molecular Formula | C15H20O3Se |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | methyl (E,2R,3S)-3-hydroxy-2-phenylselanyloct-4-enoate |
| SMILES | CCC/C=C/[C@H](O)[C@@H]([Se]c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H20O3Se/c1-3-4-6-11-13(16)14(15(17)18-2)19-12-9-7-5-8-10-12/h5-11,13-14,16H,3-4H2,1-2H3/b11-6+/t13-,14+/m0/s1 |
| InChIKey | FPLWRRXQMJDPIS-QWAJQTJBSA-N |
| XLogP | 1.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|