C17H18O2Se — CID 101116588
(1R,2S)-1-hydroxy-1-phenyl-2-phenylselanylpentan-3-one (PubChem CID 101116588) has the molecular formula C17H18O2Se and a molecular weight of 333.29 g/mol. Its IUPAC name is (1R,2S)-1-hydroxy-1-phenyl-2-phenylselanylpentan-3-one.
| Compound Name | (1R,2S)-1-hydroxy-1-phenyl-2-phenylselanylpentan-3-one |
|---|---|
| PubChem CID | 101116588 |
| Molecular Formula | C17H18O2Se |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (1R,2S)-1-hydroxy-1-phenyl-2-phenylselanylpentan-3-one |
| SMILES | CCC(=O)[C@@H]([Se]c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H18O2Se/c1-2-15(18)17(20-14-11-7-4-8-12-14)16(19)13-9-5-3-6-10-13/h3-12,16-17,19H,2H2,1H3/t16-,17-/m1/s1 |
| InChIKey | XYJFXRGWKYAJQL-IAGOWNOFSA-N |
| XLogP | 2.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|