C16H23NO4Se — CID 15322369
dimethyl (2R,3S)-2-(diethylamino)-3-phenylselanylbutanedioate (PubChem CID 15322369) has the molecular formula C16H23NO4Se and a molecular weight of 372.32 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-(diethylamino)-3-phenylselanylbutanedioate.
| Compound Name | dimethyl (2R,3S)-2-(diethylamino)-3-phenylselanylbutanedioate |
|---|---|
| PubChem CID | 15322369 |
| Molecular Formula | C16H23NO4Se |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | dimethyl (2R,3S)-2-(diethylamino)-3-phenylselanylbutanedioate |
| SMILES | CCN(CC)[C@H](C(=O)OC)[C@H]([Se]c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H23NO4Se/c1-5-17(6-2)13(15(18)20-3)14(16(19)21-4)22-12-10-8-7-9-11-12/h7-11,13-14H,5-6H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | GLUUYFBKWHNXIF-KBPBESRZSA-N |
| XLogP | 0.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|