C12H19NO — CID 134856977
cyclopenta-2,4-dien-1-ylidene-[di(propan-2-yl)amino]methanol (PubChem CID 134856977) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylidene-[di(propan-2-yl)amino]methanol.
| Compound Name | cyclopenta-2,4-dien-1-ylidene-[di(propan-2-yl)amino]methanol |
|---|---|
| PubChem CID | 134856977 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylidene-[di(propan-2-yl)amino]methanol |
| SMILES | CC(C)N(C(O)=C1C=CC=C1)C(C)C |
| InChI | InChI=1S/C12H19NO/c1-9(2)13(10(3)4)12(14)11-7-5-6-8-11/h5-10,14H,1-4H3 |
| InChIKey | WUETZFVJMWLJBL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|