C11H17NO — CID 178074578
(Z)-dimethylamino-(2-propylcyclopenta-2,4-dien-1-ylidene)methanol (PubChem CID 178074578) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (Z)-dimethylamino-(2-propylcyclopenta-2,4-dien-1-ylidene)methanol.
| Compound Name | (Z)-dimethylamino-(2-propylcyclopenta-2,4-dien-1-ylidene)methanol |
|---|---|
| PubChem CID | 178074578 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (Z)-dimethylamino-(2-propylcyclopenta-2,4-dien-1-ylidene)methanol |
| SMILES | CCCC1=CC=C/C1=C(/O)N(C)C |
| InChI | InChI=1S/C11H17NO/c1-4-6-9-7-5-8-10(9)11(13)12(2)3/h5,7-8,13H,4,6H2,1-3H3/b11-10- |
| InChIKey | QGUFEMNNUZLBCP-KHPPLWFESA-N |
| XLogP | 2.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|