C15H25NO — CID 143844577
1-[[(2S)-butan-2-yl]-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-yl]amino]ethenol (PubChem CID 143844577) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-[[(2S)-butan-2-yl]-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-yl]amino]ethenol.
| Compound Name | 1-[[(2S)-butan-2-yl]-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-yl]amino]ethenol |
|---|---|
| PubChem CID | 143844577 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-[[(2S)-butan-2-yl]-[(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-yl]amino]ethenol |
| SMILES | C=C(C)/C(=C\C(C)=C/C)N(C(=C)O)[C@@H](C)CC |
| InChI | InChI=1S/C15H25NO/c1-8-12(5)10-15(11(3)4)16(14(7)17)13(6)9-2/h8,10,13,17H,3,7,9H2,1-2,4-6H3/b12-8-,15-10+/t13-/m0/s1 |
| InChIKey | MSOHXTKFUUHRSO-YAKWIDRYSA-N |
| XLogP | 4.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|