C16H28OSi — CID 134857047
[(4S)-2-but-3-ynyl-4-propan-2-ylcyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 134857047) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is [(4S)-2-but-3-ynyl-4-propan-2-ylcyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [(4S)-2-but-3-ynyl-4-propan-2-ylcyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134857047 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | [(4S)-2-but-3-ynyl-4-propan-2-ylcyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | C#CCCC1=C(O[Si](C)(C)C)CC[C@H](C(C)C)C1 |
| InChI | InChI=1S/C16H28OSi/c1-7-8-9-15-12-14(13(2)3)10-11-16(15)17-18(4,5)6/h1,13-14H,8-12H2,2-6H3/t14-/m0/s1 |
| InChIKey | RKTXFHACNBPISF-AWEZNQCLSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|