C16H32OSi — CID 10516145
tert-butyl-[(5R,6R)-6-deuterio-5-methyl-2-propan-2-ylcyclohexen-1-yl]oxy-dimethylsilane (PubChem CID 10516145) has the molecular formula C16H32OSi and a molecular weight of 269.52 g/mol. Its IUPAC name is tert-butyl-[(5R,6R)-6-deuterio-5-methyl-2-propan-2-ylcyclohexen-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5R,6R)-6-deuterio-5-methyl-2-propan-2-ylcyclohexen-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10516145 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.23 |
| IUPAC Name | tert-butyl-[(5R,6R)-6-deuterio-5-methyl-2-propan-2-ylcyclohexen-1-yl]oxy-dimethylsilane |
| SMILES | [2H][C@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(C)C)CC[C@H]1C |
| InChI | InChI=1S/C16H32OSi/c1-12(2)14-10-9-13(3)11-15(14)17-18(7,8)16(4,5)6/h12-13H,9-11H2,1-8H3/t13-/m1/s1/i11D/t11-,13- |
| InChIKey | UFUVCDZJDAONMJ-KHIZINBRSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|