C15H27FOSi — CID 123304026
(2-fluoro-4-hex-1-en-2-ylcyclohexen-1-yl)oxy-trimethylsilane (PubChem CID 123304026) has the molecular formula C15H27FOSi and a molecular weight of 270.46 g/mol. Its IUPAC name is (2-fluoro-4-hex-1-en-2-ylcyclohexen-1-yl)oxy-trimethylsilane.
| Compound Name | (2-fluoro-4-hex-1-en-2-ylcyclohexen-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 123304026 |
| Molecular Formula | C15H27FOSi |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2-fluoro-4-hex-1-en-2-ylcyclohexen-1-yl)oxy-trimethylsilane |
| SMILES | C=C(CCCC)C1CCC(O[Si](C)(C)C)=C(F)C1 |
| InChI | InChI=1S/C15H27FOSi/c1-6-7-8-12(2)13-9-10-15(14(16)11-13)17-18(3,4)5/h13H,2,6-11H2,1,3-5H3 |
| InChIKey | KMRBOUZRJGDZMC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|