C12H17F7OSi — CID 14914237
[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 14914237) has the molecular formula C12H17F7OSi and a molecular weight of 338.34 g/mol. Its IUPAC name is [2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 14914237 |
| Molecular Formula | C12H17F7OSi |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=C(C(F)(C(F)(F)F)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C12H17F7OSi/c1-21(2,3)20-9-7-5-4-6-8(9)10(13,11(14,15)16)12(17,18)19/h4-7H2,1-3H3 |
| InChIKey | AOQYMYSWAQYOTL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|