C11H22OSi — CID 10921518
[(6R)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 10921518) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is [(6R)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [(6R)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10921518 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [(6R)-2,6-dimethylcyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | CC1=C(O[Si](C)(C)C)[C@H](C)CCC1 |
| InChI | InChI=1S/C11H22OSi/c1-9-7-6-8-10(2)11(9)12-13(3,4)5/h9H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | ZDXAHOGJVIYMLD-SECBINFHSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|