About [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane
[1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane (PubChem CID 135075231) has the molecular formula C23H44OSi
and a molecular weight of 364.69 g/mol. Its IUPAC name is [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane |
| PubChem CID | 135075231 |
| Molecular Formula | C23H44OSi |
| Molecular Weight | 364.69 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane |
| SMILES | CCCCC1=C(CCCC)C1C1(O[Si](C(C)C)(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C23H44OSi/c1-9-11-13-20-21(14-12-10-2)22(20)23(15-16-23)24-25(17(3)4,18(5)6)19(7)8/h17-19,22H,9-16H2,1-8H3 |
| InChIKey | ILGBKVJLFJJDSL-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.69 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane?
The IUPAC name of [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane (CID 135075231) is [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane.
What is the SMILES notation for [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane?
The canonical SMILES for [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane is CCCCC1=C(CCCC)C1C1(O[Si](C(C)C)(C(C)C)C(C)C)CC1.
What is the InChIKey of [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane?
The InChIKey is ILGBKVJLFJJDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44OSi/c1-9-11-13-20-21(14-12-10-2)22(20)23(15-16-23)24-25(17(3)4,18(5)6)19(7)8/h17-19,22H,9-16H2,1-8H3.
What are the key properties of [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane?
[1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane has a molecular weight of 364.69 g/mol, XLogP of 8.02, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dibutylcycloprop-2-en-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 135075231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).