C19H36OSi2 — CID 11110491
trimethyl-[(3S,4R)-2,3,4-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexen-1-yl]oxysilane (PubChem CID 11110491) has the molecular formula C19H36OSi2 and a molecular weight of 336.67 g/mol. Its IUPAC name is trimethyl-[(3S,4R)-2,3,4-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[(3S,4R)-2,3,4-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 11110491 |
| Molecular Formula | C19H36OSi2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | trimethyl-[(3S,4R)-2,3,4-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohexen-1-yl]oxysilane |
| SMILES | CC1=C(O[Si](C)(C)C)CC[C@@H](C)[C@]1(C)CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H36OSi2/c1-16-12-13-18(20-22(7,8)9)17(2)19(16,3)14-10-11-15-21(4,5)6/h16H,10,12-14H2,1-9H3/t16-,19+/m1/s1 |
| InChIKey | IFJAIRAIIOKQLD-APWZRJJASA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|