C17H26O — CID 134857056
2-cyclohexyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 134857056) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-cyclohexyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2-cyclohexyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 134857056 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-cyclohexyl-7-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC(C)(C)OC1C2C=CC1C(C1CCCCC1)=C2 |
| InChI | InChI=1S/C17H26O/c1-17(2,3)18-16-13-9-10-14(16)15(11-13)12-7-5-4-6-8-12/h9-14,16H,4-8H2,1-3H3 |
| InChIKey | QJJGFQVQYCHRBB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|