C11H16 — CID 134857609
(4E,6E)-4,6-dimethylnona-4,6-dien-2-yne (PubChem CID 134857609) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (4E,6E)-4,6-dimethylnona-4,6-dien-2-yne.
| Compound Name | (4E,6E)-4,6-dimethylnona-4,6-dien-2-yne |
|---|---|
| PubChem CID | 134857609 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (4E,6E)-4,6-dimethylnona-4,6-dien-2-yne |
| SMILES | CC#C/C(C)=C/C(C)=C/CC |
| InChI | InChI=1S/C11H16/c1-5-7-10(3)9-11(4)8-6-2/h7,9H,5H2,1-4H3/b10-7+,11-9+ |
| InChIKey | JLMVPNQIKAMVMI-PPZOTWNKSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|