C25H35NO5 — CID 134857867
methyl (3aR,6R,7aS)-1-benzyl-6-[2-(2-ethoxyethoxy)acetyl]-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate (PubChem CID 134857867) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl (3aR,6R,7aS)-1-benzyl-6-[2-(2-ethoxyethoxy)acetyl]-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate.
| Compound Name | methyl (3aR,6R,7aS)-1-benzyl-6-[2-(2-ethoxyethoxy)acetyl]-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate |
|---|---|
| PubChem CID | 134857867 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | methyl (3aR,6R,7aS)-1-benzyl-6-[2-(2-ethoxyethoxy)acetyl]-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate |
| SMILES | CCOCCOCC(=O)[C@@H]1C[C@@H]2N(Cc3ccccc3)CC[C@]2(C)C(C)=C1C(=O)OC |
| InChI | InChI=1S/C25H35NO5/c1-5-30-13-14-31-17-21(27)20-15-22-25(3,18(2)23(20)24(28)29-4)11-12-26(22)16-19-9-7-6-8-10-19/h6-10,20,22H,5,11-17H2,1-4H3/t20-,22-,25+/m0/s1 |
| InChIKey | IAVACILDRQDPEB-UWDQQESISA-N |
| XLogP | 3.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|