C20H25NO3 — CID 134834857
methyl (3aR,6R,7aS)-1-benzyl-6-formyl-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate (PubChem CID 134834857) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl (3aR,6R,7aS)-1-benzyl-6-formyl-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate.
| Compound Name | methyl (3aR,6R,7aS)-1-benzyl-6-formyl-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate |
|---|---|
| PubChem CID | 134834857 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl (3aR,6R,7aS)-1-benzyl-6-formyl-3a,4-dimethyl-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate |
| SMILES | COC(=O)C1=C(C)[C@@]2(C)CCN(Cc3ccccc3)[C@H]2C[C@H]1C=O |
| InChI | InChI=1S/C20H25NO3/c1-14-18(19(23)24-3)16(13-22)11-17-20(14,2)9-10-21(17)12-15-7-5-4-6-8-15/h4-8,13,16-17H,9-12H2,1-3H3/t16-,17-,20+/m0/s1 |
| InChIKey | VDHXZBZKXKQCKH-ABSDTBQOSA-N |
| XLogP | 2.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|