C16H17NO3 — CID 101481103
methyl (8aR)-7-oxo-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizine-6-carboxylate (PubChem CID 101481103) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl (8aR)-7-oxo-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizine-6-carboxylate.
| Compound Name | methyl (8aR)-7-oxo-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizine-6-carboxylate |
|---|---|
| PubChem CID | 101481103 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl (8aR)-7-oxo-5-phenyl-2,3,8,8a-tetrahydro-1H-indolizine-6-carboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)N2CCC[C@@H]2CC1=O |
| InChI | InChI=1S/C16H17NO3/c1-20-16(19)14-13(18)10-12-8-5-9-17(12)15(14)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | PVMYJJRVWTZMQG-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|