C17H21NO3 — CID 11716192
methyl (3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 11716192) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl (3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | methyl (3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 11716192 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl (3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)N2[C@@H](c3ccccc3)CO[C@]2(C)CC1 |
| InChI | InChI=1S/C17H21NO3/c1-12-14(16(19)20-3)9-10-17(2)18(12)15(11-21-17)13-7-5-4-6-8-13/h4-8,15H,9-11H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | VKQOLVFWVNDPEU-NVXWUHKLSA-N |
| XLogP | 3.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |