C17H21NO3 — CID 10891499
methyl (2E)-2-[(3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate (PubChem CID 10891499) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl (2E)-2-[(3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate |
|---|---|
| PubChem CID | 10891499 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl (2E)-2-[(3S,8aR)-8a-methyl-3-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CCC[C@@]2(C)OC[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C17H21NO3/c1-17-10-6-9-14(11-16(19)20-2)18(17)15(12-21-17)13-7-4-3-5-8-13/h3-5,7-8,11,15H,6,9-10,12H2,1-2H3/b14-11+/t15-,17-/m1/s1 |
| InChIKey | LDERMVCUYSNHIB-UCGSKFKCSA-N |
| XLogP | 3.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|