C20H25NO6 — CID 134918626
methyl (2E)-2-[(5S,6S)-5-acetyloxy-6-(acetyloxymethyl)-1-benzylpiperidin-2-ylidene]acetate (PubChem CID 134918626) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is methyl (2E)-2-[(5S,6S)-5-acetyloxy-6-(acetyloxymethyl)-1-benzylpiperidin-2-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(5S,6S)-5-acetyloxy-6-(acetyloxymethyl)-1-benzylpiperidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 134918626 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | methyl (2E)-2-[(5S,6S)-5-acetyloxy-6-(acetyloxymethyl)-1-benzylpiperidin-2-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@H](OC(C)=O)[C@H](COC(C)=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO6/c1-14(22)26-13-18-19(27-15(2)23)10-9-17(11-20(24)25-3)21(18)12-16-7-5-4-6-8-16/h4-8,11,18-19H,9-10,12-13H2,1-3H3/b17-11+/t18-,19-/m0/s1 |
| InChIKey | OSARCJBWYMCTBL-GFLCFMILSA-N |
| XLogP | 2.20 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|