C18H21F2NO2 — CID 138977280
4-[benzyl(2,2-difluoroethyl)amino]-1-oxaspiro[4.5]dec-3-en-2-one (PubChem CID 138977280) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-[benzyl(2,2-difluoroethyl)amino]-1-oxaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-[benzyl(2,2-difluoroethyl)amino]-1-oxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 138977280 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-[benzyl(2,2-difluoroethyl)amino]-1-oxaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1C=C(N(Cc2ccccc2)CC(F)F)C2(CCCCC2)O1 |
| InChI | InChI=1S/C18H21F2NO2/c19-16(20)13-21(12-14-7-3-1-4-8-14)15-11-17(22)23-18(15)9-5-2-6-10-18/h1,3-4,7-8,11,16H,2,5-6,9-10,12-13H2 |
| InChIKey | PXRIJILZEYHEJV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |