C19H25NO2 — CID 134844469
tert-butyl 1-benzyl-2,4-dimethyl-4H-pyridine-3-carboxylate (PubChem CID 134844469) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl 1-benzyl-2,4-dimethyl-4H-pyridine-3-carboxylate.
| Compound Name | tert-butyl 1-benzyl-2,4-dimethyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134844469 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | tert-butyl 1-benzyl-2,4-dimethyl-4H-pyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)C(C)C=CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-14-11-12-20(13-16-9-7-6-8-10-16)15(2)17(14)18(21)22-19(3,4)5/h6-12,14H,13H2,1-5H3 |
| InChIKey | RVQKDXGJUKFTDP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |