C20H27NO2 — CID 101444969
tert-butyl 1-benzyl-2,4,4-trimethylpyridine-3-carboxylate (PubChem CID 101444969) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl 1-benzyl-2,4,4-trimethylpyridine-3-carboxylate.
| Compound Name | tert-butyl 1-benzyl-2,4,4-trimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 101444969 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl 1-benzyl-2,4,4-trimethylpyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)C(C)(C)C=CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO2/c1-15-17(18(22)23-19(2,3)4)20(5,6)12-13-21(15)14-16-10-8-7-9-11-16/h7-13H,14H2,1-6H3 |
| InChIKey | IOZFMNUKRVSRGN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |