C27H29NO9 — CID 46835081
dimethyl 1-[(1R)-1-[benzyl-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 46835081) has the molecular formula C27H29NO9 and a molecular weight of 511.53 g/mol. Its IUPAC name is dimethyl 1-[(1R)-1-[benzyl-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[(1R)-1-[benzyl-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 46835081 |
| Molecular Formula | C27H29NO9 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | dimethyl 1-[(1R)-1-[benzyl-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]but-3-enyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | C=CC[C@@H](N(Cc1ccccc1)/C(=C\C(=O)OC)C(=O)OC)C12C=CC(O1)C(C(=O)OC)=C2C(=O)OC |
| InChI | InChI=1S/C27H29NO9/c1-6-10-20(27-14-13-19(37-27)22(25(31)35-4)23(27)26(32)36-5)28(16-17-11-8-7-9-12-17)18(24(30)34-3)15-21(29)33-2/h6-9,11-15,19-20H,1,10,16H2,2-5H3/b18-15-/t19?,20-,27?/m1/s1 |
| InChIKey | WFTVBZCBLJNXBF-FCOAUXJESA-N |
| XLogP | 2.01 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|