C16H19NO3 — CID 11265773
methyl (2E)-2-[(3S,7aR)-7a-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ylidene]acetate (PubChem CID 11265773) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is methyl (2E)-2-[(3S,7aR)-7a-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(3S,7aR)-7a-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ylidene]acetate |
|---|---|
| PubChem CID | 11265773 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | methyl (2E)-2-[(3S,7aR)-7a-methyl-3-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@@]2(C)OC[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C16H19NO3/c1-16-9-8-13(10-15(18)19-2)17(16)14(11-20-16)12-6-4-3-5-7-12/h3-7,10,14H,8-9,11H2,1-2H3/b13-10+/t14-,16-/m1/s1 |
| InChIKey | LGSWZDCXDWVOSJ-RNTKJRCOSA-N |
| XLogP | 2.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|