C16H16F3NO3 — CID 15350958
methyl (3S,8aS)-3-phenyl-8a-(trifluoromethyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-carboxylate (PubChem CID 15350958) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is methyl (3S,8aS)-3-phenyl-8a-(trifluoromethyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-carboxylate.
| Compound Name | methyl (3S,8aS)-3-phenyl-8a-(trifluoromethyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 15350958 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | methyl (3S,8aS)-3-phenyl-8a-(trifluoromethyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridine-5-carboxylate |
| SMILES | COC(=O)C1=CCC[C@@]2(C(F)(F)F)OC[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C16H16F3NO3/c1-22-14(21)12-8-5-9-15(16(17,18)19)20(12)13(10-23-15)11-6-3-2-4-7-11/h2-4,6-8,13H,5,9-10H2,1H3/t13-,15+/m1/s1 |
| InChIKey | YYNKKPJEHRMVIO-HIFRSBDPSA-N |
| XLogP | 3.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |