C22H27NO6 — CID 100932198
6-O-ethyl 1-O,3-O-dimethyl (1S,3S,8aS)-3-methyl-5-phenyl-2,7,8,8a-tetrahydro-1H-indolizine-1,3,6-tricarboxylate (PubChem CID 100932198) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 6-O-ethyl 1-O,3-O-dimethyl (1S,3S,8aS)-3-methyl-5-phenyl-2,7,8,8a-tetrahydro-1H-indolizine-1,3,6-tricarboxylate.
| Compound Name | 6-O-ethyl 1-O,3-O-dimethyl (1S,3S,8aS)-3-methyl-5-phenyl-2,7,8,8a-tetrahydro-1H-indolizine-1,3,6-tricarboxylate |
|---|---|
| PubChem CID | 100932198 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 6-O-ethyl 1-O,3-O-dimethyl (1S,3S,8aS)-3-methyl-5-phenyl-2,7,8,8a-tetrahydro-1H-indolizine-1,3,6-tricarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N2[C@@H](CC1)[C@@H](C(=O)OC)C[C@@]2(C)C(=O)OC |
| InChI | InChI=1S/C22H27NO6/c1-5-29-20(25)15-11-12-17-16(19(24)27-3)13-22(2,21(26)28-4)23(17)18(15)14-9-7-6-8-10-14/h6-10,16-17H,5,11-13H2,1-4H3/t16-,17-,22-/m0/s1 |
| InChIKey | HJIADUUEJXCXHL-HOIFWPIMSA-N |
| XLogP | 2.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|