C26H29NO5 — CID 101478837
ethyl (2R,4S,5R)-4-acetyl-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenylpyrrolidine-2-carboxylate (PubChem CID 101478837) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl (2R,4S,5R)-4-acetyl-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2R,4S,5R)-4-acetyl-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 101478837 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | ethyl (2R,4S,5R)-4-acetyl-1-[(E)-4-oxo-4-phenylmethoxybut-2-en-2-yl]-5-phenylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](C(C)=O)[C@H](c2ccccc2)N1/C(C)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29NO5/c1-4-31-26(30)23-16-22(19(3)28)25(21-13-9-6-10-14-21)27(23)18(2)15-24(29)32-17-20-11-7-5-8-12-20/h5-15,22-23,25H,4,16-17H2,1-3H3/b18-15+/t22-,23-,25+/m1/s1 |
| InChIKey | KPTQXUHNOFAHRO-LHJFDVABSA-N |
| XLogP | 4.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|