C26H25NO4 — CID 101254393
2-O-benzyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate (PubChem CID 101254393) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-O-benzyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-benzyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 101254393 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-O-benzyl 4-O-methyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](C(=O)OCc2ccccc2)N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H25NO4/c1-30-25(28)22-17-23(26(29)31-18-19-11-5-2-6-12-19)27(21-15-9-4-10-16-21)24(22)20-13-7-3-8-14-20/h2-16,22-24H,17-18H2,1H3/t22-,23+,24-/m0/s1 |
| InChIKey | DTRYYDPMHOUMKS-VXNXHJTFSA-N |
| XLogP | 4.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |