C24H25NO4 — CID 138963930
diethyl (1S,5S)-2,3-diphenyl-2-azabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate (PubChem CID 138963930) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is diethyl (1S,5S)-2,3-diphenyl-2-azabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate.
| Compound Name | diethyl (1S,5S)-2,3-diphenyl-2-azabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 138963930 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | diethyl (1S,5S)-2,3-diphenyl-2-azabicyclo[3.2.0]hept-6-ene-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@@H]2CC(c3ccccc3)N(c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C24H25NO4/c1-3-28-23(26)20-18-15-19(16-11-7-5-8-12-16)25(17-13-9-6-10-14-17)22(18)21(20)24(27)29-4-2/h5-14,18-19,22H,3-4,15H2,1-2H3/t18-,19?,22-/m0/s1 |
| InChIKey | FXZYDFHVLJUGOU-NOAQKIQUSA-N |
| XLogP | 4.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |