C21H27NO6 — CID 134846111
8a-O-ethyl 1-O,2-O-dimethyl (3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine-1,2,8a-tricarboxylate (PubChem CID 134846111) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 8a-O-ethyl 1-O,2-O-dimethyl (3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine-1,2,8a-tricarboxylate.
| Compound Name | 8a-O-ethyl 1-O,2-O-dimethyl (3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine-1,2,8a-tricarboxylate |
|---|---|
| PubChem CID | 134846111 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 8a-O-ethyl 1-O,2-O-dimethyl (3S,8aS)-3-phenyl-2,3,5,6,7,8-hexahydro-1H-indolizine-1,2,8a-tricarboxylate |
| SMILES | CCOC(=O)[C@@]12CCCCN1[C@H](c1ccccc1)C(C(=O)OC)C2C(=O)OC |
| InChI | InChI=1S/C21H27NO6/c1-4-28-20(25)21-12-8-9-13-22(21)17(14-10-6-5-7-11-14)15(18(23)26-2)16(21)19(24)27-3/h5-7,10-11,15-17H,4,8-9,12-13H2,1-3H3/t15?,16?,17-,21+/m1/s1 |
| InChIKey | ITBSRMMSRSFOLS-NOKFLLHDSA-N |
| XLogP | 2.11 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|