C24H26F3NO6 — CID 135072898
2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-2-prop-2-enyl-1-prop-2-ynyl-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate (PubChem CID 135072898) has the molecular formula C24H26F3NO6 and a molecular weight of 481.47 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-2-prop-2-enyl-1-prop-2-ynyl-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-2-prop-2-enyl-1-prop-2-ynyl-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135072898 |
| Molecular Formula | C24H26F3NO6 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-2-prop-2-enyl-1-prop-2-ynyl-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate |
| SMILES | C#CCN1[C@H](c2ccc(C(F)(F)F)cc2)[C@H](C(=O)OC)[C@H](C(=O)OC)[C@]1(CC=C)C(=O)OCC |
| InChI | InChI=1S/C24H26F3NO6/c1-6-13-23(22(31)34-8-3)18(21(30)33-5)17(20(29)32-4)19(28(23)14-7-2)15-9-11-16(12-10-15)24(25,26)27/h2,6,9-12,17-19H,1,8,13-14H2,3-5H3/t17-,18-,19-,23-/m1/s1 |
| InChIKey | HICDABLEUCXPBF-FZONSQQESA-N |
| XLogP | 3.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|