C25H29NO7 — CID 71560637
9a-O-ethyl 1-O,2-O-dimethyl (1S,2R,3S,8aS,9aR)-6-methyl-7-oxo-3-phenyl-2,3,5,8,8a,9-hexahydro-1H-cyclopenta[f]indolizine-1,2,9a-tricarboxylate (PubChem CID 71560637) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 9a-O-ethyl 1-O,2-O-dimethyl (1S,2R,3S,8aS,9aR)-6-methyl-7-oxo-3-phenyl-2,3,5,8,8a,9-hexahydro-1H-cyclopenta[f]indolizine-1,2,9a-tricarboxylate.
| Compound Name | 9a-O-ethyl 1-O,2-O-dimethyl (1S,2R,3S,8aS,9aR)-6-methyl-7-oxo-3-phenyl-2,3,5,8,8a,9-hexahydro-1H-cyclopenta[f]indolizine-1,2,9a-tricarboxylate |
|---|---|
| PubChem CID | 71560637 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 9a-O-ethyl 1-O,2-O-dimethyl (1S,2R,3S,8aS,9aR)-6-methyl-7-oxo-3-phenyl-2,3,5,8,8a,9-hexahydro-1H-cyclopenta[f]indolizine-1,2,9a-tricarboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H]3CC(=O)C(C)=C3CN1[C@H](c1ccccc1)[C@H](C(=O)OC)[C@@H]2C(=O)OC |
| InChI | InChI=1S/C25H29NO7/c1-5-33-24(30)25-12-16-11-18(27)14(2)17(16)13-26(25)21(15-9-7-6-8-10-15)19(22(28)31-3)20(25)23(29)32-4/h6-10,16,19-21H,5,11-13H2,1-4H3/t16-,19-,20-,21-,25-/m1/s1 |
| InChIKey | DURBSYVWNDELED-SJWHBQIWSA-N |
| XLogP | 2.23 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|