C21H27NO3 — CID 134834858
methyl (3aR,6R,7aS)-1-benzyl-3a,4-dimethyl-6-[(2R)-oxiran-2-yl]-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate (PubChem CID 134834858) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl (3aR,6R,7aS)-1-benzyl-3a,4-dimethyl-6-[(2R)-oxiran-2-yl]-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate.
| Compound Name | methyl (3aR,6R,7aS)-1-benzyl-3a,4-dimethyl-6-[(2R)-oxiran-2-yl]-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate |
|---|---|
| PubChem CID | 134834858 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (3aR,6R,7aS)-1-benzyl-3a,4-dimethyl-6-[(2R)-oxiran-2-yl]-3,6,7,7a-tetrahydro-2H-indole-5-carboxylate |
| SMILES | COC(=O)C1=C(C)[C@@]2(C)CCN(Cc3ccccc3)[C@H]2C[C@H]1[C@@H]1CO1 |
| InChI | InChI=1S/C21H27NO3/c1-14-19(20(23)24-3)16(17-13-25-17)11-18-21(14,2)9-10-22(18)12-15-7-5-4-6-8-15/h4-8,16-18H,9-13H2,1-3H3/t16-,17-,18-,21+/m0/s1 |
| InChIKey | FFJLCEFUEZUDTN-RYLXDESZSA-N |
| XLogP | 3.18 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|