C20H25NO5 — CID 122366153
2-O-ethyl 5-O-methyl (2S,3aS,7R,7aS)-1-benzyl-7-hydroxy-2,3,3a,6,7,7a-hexahydroindole-2,5-dicarboxylate (PubChem CID 122366153) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-O-ethyl 5-O-methyl (2S,3aS,7R,7aS)-1-benzyl-7-hydroxy-2,3,3a,6,7,7a-hexahydroindole-2,5-dicarboxylate.
| Compound Name | 2-O-ethyl 5-O-methyl (2S,3aS,7R,7aS)-1-benzyl-7-hydroxy-2,3,3a,6,7,7a-hexahydroindole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 122366153 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-O-ethyl 5-O-methyl (2S,3aS,7R,7aS)-1-benzyl-7-hydroxy-2,3,3a,6,7,7a-hexahydroindole-2,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]2C=C(C(=O)OC)C[C@@H](O)[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO5/c1-3-26-20(24)16-10-14-9-15(19(23)25-2)11-17(22)18(14)21(16)12-13-7-5-4-6-8-13/h4-9,14,16-18,22H,3,10-12H2,1-2H3/t14-,16+,17-,18+/m1/s1 |
| InChIKey | FKISJTAYXWDHCI-SPUZQDLCSA-N |
| XLogP | 1.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |