C28H31NO3 — CID 134918779
methyl (4S,5S)-5-(dibenzylamino)-4-hydroxy-2-methylidene-6-phenylhexanoate (PubChem CID 134918779) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is methyl (4S,5S)-5-(dibenzylamino)-4-hydroxy-2-methylidene-6-phenylhexanoate.
| Compound Name | methyl (4S,5S)-5-(dibenzylamino)-4-hydroxy-2-methylidene-6-phenylhexanoate |
|---|---|
| PubChem CID | 134918779 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | methyl (4S,5S)-5-(dibenzylamino)-4-hydroxy-2-methylidene-6-phenylhexanoate |
| SMILES | C=C(C[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C28H31NO3/c1-22(28(31)32-2)18-27(30)26(19-23-12-6-3-7-13-23)29(20-24-14-8-4-9-15-24)21-25-16-10-5-11-17-25/h3-17,26-27,30H,1,18-21H2,2H3/t26-,27-/m0/s1 |
| InChIKey | CESMIUBNOLMUHV-SVBPBHIXSA-N |
| XLogP | 4.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|