C11H19NO — CID 134857937
(3S)-2,4-dimethyl-3-pyrrol-1-ylpentan-1-ol (PubChem CID 134857937) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3S)-2,4-dimethyl-3-pyrrol-1-ylpentan-1-ol.
| Compound Name | (3S)-2,4-dimethyl-3-pyrrol-1-ylpentan-1-ol |
|---|---|
| PubChem CID | 134857937 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3S)-2,4-dimethyl-3-pyrrol-1-ylpentan-1-ol |
| SMILES | CC(C)[C@@H](C(C)CO)n1cccc1 |
| InChI | InChI=1S/C11H19NO/c1-9(2)11(10(3)8-13)12-6-4-5-7-12/h4-7,9-11,13H,8H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | RBSAMLGONAWSTJ-DTIOYNMSSA-N |
| XLogP | 2.31 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |