C11H13NO4S2 — CID 134858073
[(4R)-2-oxo-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134858073) has the molecular formula C11H13NO4S2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [(4R)-2-oxo-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R)-2-oxo-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134858073 |
| Molecular Formula | C11H13NO4S2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | [(4R)-2-oxo-1,3-thiazolidin-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CSC(=O)N2)cc1 |
| InChI | InChI=1S/C11H13NO4S2/c1-8-2-4-10(5-3-8)18(14,15)16-6-9-7-17-11(13)12-9/h2-5,9H,6-7H2,1H3,(H,12,13)/t9-/m1/s1 |
| InChIKey | RUHMIDVBUDLRBL-SECBINFHSA-N |
| XLogP | 1.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|