C10H18O2 — CID 134858477
(5R)-7,8-dimethyl-1,6-dioxaspiro[4.5]decane (PubChem CID 134858477) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (5R)-7,8-dimethyl-1,6-dioxaspiro[4.5]decane.
| Compound Name | (5R)-7,8-dimethyl-1,6-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134858477 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (5R)-7,8-dimethyl-1,6-dioxaspiro[4.5]decane |
| SMILES | CC1CC[C@]2(CCCO2)OC1C |
| InChI | InChI=1S/C10H18O2/c1-8-4-6-10(12-9(8)2)5-3-7-11-10/h8-9H,3-7H2,1-2H3/t8?,9?,10-/m0/s1 |
| InChIKey | WUHCCLVLJUOQIF-RTBKNWGFSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |