C13H13F3N2O2 — CID 134858793
N-[1-(4-cyanophenyl)-3,3,3-trifluoro-1-methoxypropyl]acetamide (PubChem CID 134858793) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-3,3,3-trifluoro-1-methoxypropyl]acetamide.
| Compound Name | N-[1-(4-cyanophenyl)-3,3,3-trifluoro-1-methoxypropyl]acetamide |
|---|---|
| PubChem CID | 134858793 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[1-(4-cyanophenyl)-3,3,3-trifluoro-1-methoxypropyl]acetamide |
| SMILES | COC(CC(F)(F)F)(NC(C)=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H13F3N2O2/c1-9(19)18-12(20-2,8-13(14,15)16)11-5-3-10(7-17)4-6-11/h3-6H,8H2,1-2H3,(H,18,19) |
| InChIKey | CEQBDJNRZURGNG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|