C12H13F4NO2 — CID 134858881
N-[3,3,3-trifluoro-1-(4-fluorophenyl)-1-methoxypropyl]acetamide (PubChem CID 134858881) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is N-[3,3,3-trifluoro-1-(4-fluorophenyl)-1-methoxypropyl]acetamide.
| Compound Name | N-[3,3,3-trifluoro-1-(4-fluorophenyl)-1-methoxypropyl]acetamide |
|---|---|
| PubChem CID | 134858881 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[3,3,3-trifluoro-1-(4-fluorophenyl)-1-methoxypropyl]acetamide |
| SMILES | COC(CC(F)(F)F)(NC(C)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13F4NO2/c1-8(18)17-11(19-2,7-12(14,15)16)9-3-5-10(13)6-4-9/h3-6H,7H2,1-2H3,(H,17,18) |
| InChIKey | JHXKJIURIRUADH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|