C14H9F12NO2 — CID 16763849
3,3,3-trifluoro-N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)-2-(trifluoromethyl)propanamide (PubChem CID 16763849) has the molecular formula C14H9F12NO2 and a molecular weight of 451.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 16763849 |
| Molecular Formula | C14H9F12NO2 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3,3,3-trifluoro-N-(1,1,1,3,3,3-hexafluoro-2-phenylmethoxypropan-2-yl)-2-(trifluoromethyl)propanamide |
| SMILES | O=C(NC(OCc1ccccc1)(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H9F12NO2/c15-10(16,17)8(11(18,19)20)9(28)27-12(13(21,22)23,14(24,25)26)29-6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,27,28) |
| InChIKey | YFYMZKJZQDWXCW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|