C14H16F3NO2 — CID 87126697
2,2,2-trifluoro-N-[(E,2R)-5-phenylmethoxypent-3-en-2-yl]acetamide (PubChem CID 87126697) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E,2R)-5-phenylmethoxypent-3-en-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E,2R)-5-phenylmethoxypent-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 87126697 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E,2R)-5-phenylmethoxypent-3-en-2-yl]acetamide |
| SMILES | C[C@H](/C=C/COCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-11(18-13(19)14(15,16)17)6-5-9-20-10-12-7-3-2-4-8-12/h2-8,11H,9-10H2,1H3,(H,18,19)/b6-5+/t11-/m1/s1 |
| InChIKey | UPJDZPYSTBCMFS-MVIFTORASA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|